|
|
|
 |
Sodium succinete tetrahydroxy |
|
| Chemical name: |
Sodium succinete tetrahydroxy |
| CAS NO.: |
2924-15-4 |
| Molecular formula: |
C4H4O8Na2 |
| Molecular weight: |
162.63 |
| Structural formula: |
NaOOC-C(OH)2-C(OH)2-COONa |
| Appearance: |
white powder |
| Assay: |
=99.0% |
| Melting point: |
155-157°C |
| packing: |
PE film bag lined drum, Net wt 25kg. |
| Storage: |
Kept in cool and ventilating place, far away from heat and fire, load gently, no breakage. |
[Close]
|
|
|